CAS 15502-52-0 is the registry number for 1,4-Bis(5-phenyl-4,5-dihydrooxazol-2-yl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-phenyl-2-[4-(5-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole (CAS 15502-52-0) is a chemical compound with the molecular formula C24H20N2O2 and a molecular weight of 368.4 g/mol. IUPAC name: 5-phenyl-2-[4-(5-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole. InChIKey: SXFWXWSOMDSZFE-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 5-phenyl-2-[4-(5-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | SXFWXWSOMDSZFE-UHFFFAOYSA-N |
| SMILES | C1C(OC(=N1)C2=CC=C(C=C2)C3=NCC(O3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)