cas: 662-22-6 — see every product listed under this CAS number, including other names
3,3,3-Trifluoro-2-hydroxy-2-(trifluoromethyl)propionic Acid, 97%, 97% (CAS 662-22-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IBR-250mg |
| cas | 662-22-6 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 918.80 Pln | |
| Chemat | 10g | 1773.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid (CAS 662-22-6) is a chemical compound with the molecular formula C4H2F6O3 and a molecular weight of 212.05 g/mol. IUPAC name: 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid. InChIKey: CMQUGOHGJUTDGZ-UHFFFAOYSA-N.
| Molecular formula | C4H2F6O3 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid |
| InChIKey | CMQUGOHGJUTDGZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(C(F)(F)F)O)O |
Computed by PubChem (NCBI)