CAS 662-22-6 appears in our catalog under these names: 2,2-Bis(trifluoromethyl)-2-hydroxyacetic acid, 95%, 3,3,3–Trifluoro–2–hydroxy–2–(trifluoromethyl)propionic Acid, 3,3,3-Trifluoro-2-hydroxy-2-(trifluoromethyl)propionic Acid, >98.0%(T), Perfluoro-2-hydroxy-2-methylpropanoic acid 97%, 3,3,3-Trifluoro-2-hydroxy-2-(trifluoromethyl)propionic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 200mg, 250mg, 10g.
3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid (CAS 662-22-6) is a chemical compound with the molecular formula C4H2F6O3 and a molecular weight of 212.05 g/mol. IUPAC name: 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid. InChIKey: CMQUGOHGJUTDGZ-UHFFFAOYSA-N.
| Molecular formula | C4H2F6O3 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid |
| InChIKey | CMQUGOHGJUTDGZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(C(F)(F)F)O)O |
Computed by PubChem (NCBI)