3,3-Dimethyl-2,4-dioxa-9-thiaspiro[5.5]undecane-1,5-dione 9,9-dioxide, 90%
cas: 64096-86-2 — see every product listed under this CAS number, including other names
3,3-Dimethyl-2,4-dioxa-9-thiaspiro[5.5]undecane-1,5-dione 9,9-dioxide, 90% (CAS 64096-86-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A899113-5mg |
| cas | 64096-86-2 |
| size | 5mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 670.75 Pln | |
| Ambeed | 10mg | 1026.75 Pln | |
| Ambeed | 25mg | 1883.38 Pln | |
| Ambeed | 50mg | 3151.62 Pln | |
| Ambeed | 100mg | 5298.75 Pln | |
| Ambeed | 250mg | 9476.19 Pln | |
| BLDpharm | 5mg | 719.77 Pln | |
| BLDpharm | 10mg | 1102.97 Pln | |
| BLDpharm | 25mg | 2024.87 Pln | |
| BLDpharm | 50mg | 3391.05 Pln | |
| BLDpharm | 100mg | 5706.90 Pln | |
| BLDpharm | 250mg | 10216.43 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione (CAS 64096-86-2) is a chemical compound with the molecular formula C10H14O6S and a molecular weight of 262.28 g/mol. IUPAC name: 3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione. InChIKey: NHXXFEVVLIQWOT-UHFFFAOYSA-N.
| Molecular formula | C10H14O6S |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione |
| InChIKey | NHXXFEVVLIQWOT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C2(CCS(=O)(=O)CC2)C(=O)O1)C |
Computed by PubChem (NCBI)
Synonyms:
3,3-dimethyl-2,4-dioxa-9lambda~6~-thiaspiro[5.5]undecane-1,5,9,9-tetraone, 3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione, 3,3-dimethyl-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5,9,9-tetrone, 3,3-Dimethyl-2,4-dioxa-9-thiaspiro[5.5]undecane-1,5-dione 9,9-dioxide, Oprea1_108851, NHXXFEVVLIQWOT-UHFFFAOYSA-N, 3,3-dimethyl-2,4-dioxa-9|E?-thiaspiro[5.5]undecane-1,5,9,9-tetrone, 3,3-Dimethyl-2,4-dioxa-9lambda~6~-thiaspiro[5.5]undecane-1,5,9,9-tetrone, 3,3-Dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thia-spiro[5.5]undecane-1,5-dione