CAS 64096-86-2 is the registry number for 3,3-Dimethyl-2,4-dioxa-9-thiaspiro[5.5]undecane-1,5-dione 9,9-dioxide, 90%. Offered by: Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione (CAS 64096-86-2) is a chemical compound with the molecular formula C10H14O6S and a molecular weight of 262.28 g/mol. IUPAC name: 3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione. InChIKey: NHXXFEVVLIQWOT-UHFFFAOYSA-N.
| Molecular formula | C10H14O6S |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 3,3-dimethyl-9,9-dioxo-2,4-dioxa-9lambda6-thiaspiro[5.5]undecane-1,5-dione |
| InChIKey | NHXXFEVVLIQWOT-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C2(CCS(=O)(=O)CC2)C(=O)O1)C |
Computed by PubChem (NCBI)