cas: 10469-09-7 — see every product listed under this CAS number, including other names
3,4,5,6-Tetrachloropicolinic acid, 98% (CAS 10469-09-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791174-1G |
| cas | 10469-09-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4,5,6-tetrachloropyridine-2-carboxylic acid (CAS 10469-09-7) is a chemical compound with the molecular formula C6HCl4NO2 and a molecular weight of 260.9 g/mol. IUPAC name: 3,4,5,6-tetrachloropyridine-2-carboxylic acid. InChIKey: GXFRQLQUKBSYQL-UHFFFAOYSA-N.
| Molecular formula | C6HCl4NO2 |
|---|---|
| Molecular weight | 260.9 g/mol |
| IUPAC name | 3,4,5,6-tetrachloropyridine-2-carboxylic acid |
| InChIKey | GXFRQLQUKBSYQL-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)