cas: 1719-88-6 — see every product listed under this CAS number, including other names
3,4,5-Trimethoxybenzoic Anhydride, >95.0%(T) (CAS 1719-88-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1093-5G |
| cas | 1719-88-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 408.46 Pln | |
| TCI | 25g | 1342.74 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
(3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate (CAS 1719-88-6) is a chemical compound with the molecular formula C20H22O9 and a molecular weight of 406.4 g/mol. IUPAC name: (3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate. InChIKey: LQJFTZJNDJDCKV-UHFFFAOYSA-N.
| Molecular formula | C20H22O9 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | (3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate |
| InChIKey | LQJFTZJNDJDCKV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)OC(=O)C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)