Products 1719-88-6
CAS 1719-88-6 appears in our catalog under these names: 3,4,5-Trimethoxybenzoic anhydride, 95%, 3，4，5–Trimethoxybenzoic Anhydride, 3,4,5-Trimethoxybenzoic acid anhydride, 3,4,5-Trimethoxybenzoic Anhydride, >95.0%(T), 3,4,5-Trimethoxybenzoic anhydride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 15g.
(3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate (CAS 1719-88-6) is a chemical compound with the molecular formula C20H22O9 and a molecular weight of 406.4 g/mol. IUPAC name: (3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate. InChIKey: LQJFTZJNDJDCKV-UHFFFAOYSA-N.
| Molecular formula | C20H22O9 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | (3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate |
| InChIKey | LQJFTZJNDJDCKV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)OC(=O)C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
(3,4,5-trimethoxybenzoyl) 3,4,5-trimethoxybenzoate, 3,3',4,4',5,5'-Hexamethoxybenzoic anhydride, 3,4,5-Trimethoxybenzoic Anhydride, 3,4,5-TrimethoxybenzoicAnhydride, 3,4,5-trimethoxybenzoyl 3,4,5-trimethoxybenzoate, 3,4,5-Trimethoxyphenyl anhydride #, Benzoic acid, 3,4,5-trimethoxy-, anhydride, 3,4,5-trimethoxybenzoic anhy-dride, 3,4,5-Trimethoxybenzoic acid anhydride