cas: 66074-00-8 — see every product listed under this CAS number, including other names
3,4-Bis(phenylsulfonyl)-1,2,5-oxadiazole 2-oxide 98% (CAS 66074-00-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1166974-250mg |
| cas | 66074-00-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1510.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1166974 |
3,4-bis(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium (CAS 66074-00-8) is a chemical compound with the molecular formula C14H10N2O6S2 and a molecular weight of 366.4 g/mol. IUPAC name: 3,4-bis(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium. InChIKey: PLIHJANRRMFJCC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O6S2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 3,4-bis(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| InChIKey | PLIHJANRRMFJCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=NO[N+](=C2S(=O)(=O)C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)