CAS 66074-00-8 appears in our catalog under these names: 3,4-Bis(phenylsulfonyl)-1,2,5-oxadiazole 2-oxide, 95%, 3,4–Bis(phenylsulfonyl)–1,2,5–oxadiazole 2–Oxide, 3,4-Bis(phenylsulfonyl)-1,2,5-oxadiazole 2-oxide 98%, 3,4-Bis(Phenylsulfonyl)-1,2,5-Oxadiazole 2-Oxide, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
3,4-bis(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium (CAS 66074-00-8) is a chemical compound with the molecular formula C14H10N2O6S2 and a molecular weight of 366.4 g/mol. IUPAC name: 3,4-bis(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium. InChIKey: PLIHJANRRMFJCC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O6S2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 3,4-bis(benzenesulfonyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| InChIKey | PLIHJANRRMFJCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=NO[N+](=C2S(=O)(=O)C3=CC=CC=C3)[O-] |
Computed by PubChem (NCBI)