cas: 1807537-43-4 — see every product listed under this CAS number, including other names
3,4-Dibromo-Mal-PEG2-N-Boc, 96% (CAS 1807537-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554808-100MG |
| cas | 1807537-43-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 1060.06 Pln | |
| Fluorochem | 1g | 4032.97 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate (CAS 1807537-43-4) is a chemical compound with the molecular formula C15H22Br2N2O6 and a molecular weight of 486.15 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate. InChIKey: XQHMCSGLWVRCQD-UHFFFAOYSA-N.
| Molecular formula | C15H22Br2N2O6 |
|---|---|
| Molecular weight | 486.15 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | XQHMCSGLWVRCQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN1C(=O)C(=C(C1=O)Br)Br |
Computed by PubChem (NCBI)