cas: 1807537-43-4 — see every product listed under this CAS number, including other names
3,4-Dibromo-mal-peg2-boc-amine 97% (CAS 1807537-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755405-100mg |
| cas | 1807537-43-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 1071.25 Pln | |
| Ambeed | 1g | 4024.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755405 |
Tert-butyl N-[2-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate (CAS 1807537-43-4) is a chemical compound with the molecular formula C15H22Br2N2O6 and a molecular weight of 486.15 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate. InChIKey: XQHMCSGLWVRCQD-UHFFFAOYSA-N.
| Molecular formula | C15H22Br2N2O6 |
|---|---|
| Molecular weight | 486.15 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | XQHMCSGLWVRCQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN1C(=O)C(=C(C1=O)Br)Br |
Computed by PubChem (NCBI)