cas: 1204810-46-7 — see every product listed under this CAS number, including other names
3,4-Dichloro-6-fluoroquinoline, 98% (CAS 1204810-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863260-100MG |
| cas | 1204810-46-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 1g | 2002.44 Pln | |
| Fluorochem | 5g | 5579.30 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dichloro-6-fluoroquinoline (CAS 1204810-46-7) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 3,4-dichloro-6-fluoroquinoline. InChIKey: NGPMJBMQUTZLKP-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 3,4-dichloro-6-fluoroquinoline |
| InChIKey | NGPMJBMQUTZLKP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1F)Cl)Cl |
Computed by PubChem (NCBI)