CAS 1204811-28-8 appears in our catalog under these names: 3,4-Dichloro-8-fluoroquinoline, 95%, 3,4-Dichloro-8-fluoroquinoline 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
3,4-dichloro-8-fluoroquinoline (CAS 1204811-28-8) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 3,4-dichloro-8-fluoroquinoline. InChIKey: VBOOTOZCRFUTOK-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 3,4-dichloro-8-fluoroquinoline |
| InChIKey | VBOOTOZCRFUTOK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C(=C1)F)Cl)Cl |
Computed by PubChem (NCBI)