cas: 1204811-28-8 — see every product listed under this CAS number, including other names
3,4-Dichloro-8-fluoroquinoline 97% (CAS 1204811-28-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A606906-100mg |
| cas | 1204811-28-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 659.62 Pln | |
| Ambeed | 1g | 1549.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A606906 |
3,4-dichloro-8-fluoroquinoline (CAS 1204811-28-8) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 3,4-dichloro-8-fluoroquinoline. InChIKey: VBOOTOZCRFUTOK-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 3,4-dichloro-8-fluoroquinoline |
| InChIKey | VBOOTOZCRFUTOK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C(=C1)F)Cl)Cl |
Computed by PubChem (NCBI)