3,4-Difluorobenzenesulfonamide, 98%
cas: 108966-71-8 — see every product listed under this CAS number, including other names
3,4-Difluorobenzenesulfonamide, 98% (CAS 108966-71-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F005522-1G |
| cas | 108966-71-8 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 336.36 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1054.85 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 25g | 387.06 Pln | |
| Ambeed | 100g | 1021.19 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1197.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
3,4-difluorobenzenesulfonamide (CAS 108966-71-8) is a chemical compound with the molecular formula C6H5F2NO2S and a molecular weight of 193.17 g/mol. IUPAC name: 3,4-difluorobenzenesulfonamide. InChIKey: VFVVRYNJTGHAIE-UHFFFAOYSA-N.
| Molecular formula | C6H5F2NO2S |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 3,4-difluorobenzenesulfonamide |
| InChIKey | VFVVRYNJTGHAIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)F)F |
Computed by PubChem (NCBI)