Products 1989659-91-7
CAS 1989659-91-7 appears in our catalog under these names: 4-Amino-2-fluorobenzene-1-sulfonyl fluoride, 4-Amino-2-fluorobenzene-1-sulfonyl fluoride 95%, 4-Amino-2-fluorobenzene-1-sulfonyl fluoride, 95%, 95%, 4-AMINO-2-FLUOROBENZENE-1-SULFONYL FLUORIDE, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
4-amino-2-fluorobenzenesulfonyl fluoride (CAS 1989659-91-7) is a chemical compound with the molecular formula C6H5F2NO2S and a molecular weight of 193.17 g/mol. IUPAC name: 4-amino-2-fluorobenzenesulfonyl fluoride. InChIKey: IDUVXPUMLXJMCN-UHFFFAOYSA-N.
| Molecular formula | C6H5F2NO2S |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 4-amino-2-fluorobenzenesulfonyl fluoride |
| InChIKey | IDUVXPUMLXJMCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)S(=O)(=O)F |
Computed by PubChem (NCBI)