cas: 910037-15-9 — see every product listed under this CAS number, including other names
3,4-Dihydro-4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrido[3,2-b]-1,4-oxazine, 98%, 98% (CAS 910037-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVF5-100mg |
| cas | 910037-15-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 851.60 Pln | |
| Chemat | 1g | 2109.20 Pln | |
| Chemat | 5g | 7226.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine (CAS 910037-15-9) is a chemical compound with the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. IUPAC name: 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine. InChIKey: PDTRXHRSCGNYFD-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O3 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| InChIKey | PDTRXHRSCGNYFD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(CCO3)C |
Computed by PubChem (NCBI)