cas: 884504-20-5 — see every product listed under this CAS number, including other names
3,4-Dimethylbenzoylacetonitrile, 98% (CAS 884504-20-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F206978-50MG |
| cas | 884504-20-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 424.87 Pln | |
| Fluorochem | 100mg | 622.72 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 500mg | 1320.39 Pln | |
| Fluorochem | 1g | 1674.43 Pln | |
| Fluorochem | 2.5g | 3538.36 Pln | |
| Fluorochem | 5g | 5095.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(3,4-dimethylphenyl)-3-oxopropanenitrile (CAS 884504-20-5) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-3-oxopropanenitrile. InChIKey: FFWSHSVDWFTXCI-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)-3-oxopropanenitrile |
| InChIKey | FFWSHSVDWFTXCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CC#N)C |
Computed by PubChem (NCBI)