cas: 884504-20-5 — see every product listed under this CAS number, including other names
3-(3,4-Dimethylphenyl)-3-oxopropanenitrile, 98%, 98% (CAS 884504-20-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115EIW-50mg |
| cas | 884504-20-5 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 155.60 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 500mg | 698.00 Pln | |
| Chemat | 1g | 918.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(3,4-dimethylphenyl)-3-oxopropanenitrile (CAS 884504-20-5) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-3-oxopropanenitrile. InChIKey: FFWSHSVDWFTXCI-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)-3-oxopropanenitrile |
| InChIKey | FFWSHSVDWFTXCI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CC#N)C |
Computed by PubChem (NCBI)