cas: 26107-82-4 — see every product listed under this CAS number, including other names
3,5-Bis(trifluoromethyl)benzhydrazide, 98%, 98% (CAS 26107-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ROR-250mg |
| cas | 26107-82-4 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 15g | 366.80 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1605.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-bis(trifluoromethyl)benzohydrazide (CAS 26107-82-4) is a chemical compound with the molecular formula C9H6F6N2O and a molecular weight of 272.15 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)benzohydrazide. InChIKey: GBBRFBSFWKFTMZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F6N2O |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)benzohydrazide |
| InChIKey | GBBRFBSFWKFTMZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)NN |
Computed by PubChem (NCBI)