cas: 3383-21-9 — see every product listed under this CAS number, including other names
3,5-Di-tert-butyl-1,2-benzoquinone, >98.0%(GC) (CAS 3383-21-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2430-5G |
| cas | 3383-21-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 290.45 Pln | |
| TCI | 25g | 1111.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione (CAS 3383-21-9) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione. InChIKey: NOUZOVBGCDDMSX-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 3,5-ditert-butylcyclohexa-3,5-diene-1,2-dione |
| InChIKey | NOUZOVBGCDDMSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)C(=O)C(=C1)C(C)(C)C |
Computed by PubChem (NCBI)