cas: 1303968-25-3 — see every product listed under this CAS number, including other names
3,5-Diamino-6-bromo-pyrazine-2-carboxylic acid, 95%, 95% (CAS 1303968-25-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110K4I-50mg |
| cas | 1303968-25-3 |
| size | 50mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 390.80 Pln | |
| Chemat | 100mg | 525.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-diamino-6-bromopyrazine-2-carboxylic acid (CAS 1303968-25-3) is a chemical compound with the molecular formula C5H5BrN4O2 and a molecular weight of 233.02 g/mol. IUPAC name: 3,5-diamino-6-bromopyrazine-2-carboxylic acid. InChIKey: FDPDGMKZZNURGR-UHFFFAOYSA-N.
| Molecular formula | C5H5BrN4O2 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 3,5-diamino-6-bromopyrazine-2-carboxylic acid |
| InChIKey | FDPDGMKZZNURGR-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Br)N)N)C(=O)O |
Computed by PubChem (NCBI)