CAS 15862-38-1 appears in our catalog under these names: 3-Bromo-2-hydrazinyl-5-nitropyridine, 97%, 3-Bromo-2-hydrazinyl-5-nitropyridine, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g.
(3-bromo-5-nitro-2-pyridinyl)hydrazine (CAS 15862-38-1) is a chemical compound with the molecular formula C5H5BrN4O2 and a molecular weight of 233.02 g/mol. IUPAC name: (3-bromo-5-nitro-2-pyridinyl)hydrazine. InChIKey: FGRGIVXZHDLCBP-UHFFFAOYSA-N.
| Molecular formula | C5H5BrN4O2 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | (3-bromo-5-nitro-2-pyridinyl)hydrazine |
| InChIKey | FGRGIVXZHDLCBP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)