cas: 433939-48-1 — see every product listed under this CAS number, including other names
3,5-Dibromo-(difluoromethoxy)benzene (CAS 433939-48-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035798-250MG |
| cas | 433939-48-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 1424.52 Pln | |
| Fluorochem | 5g | 6297.80 Pln |
| delivery time | 2-3 weeks |
|---|
1,3-dibromo-5-(difluoromethoxy)benzene (CAS 433939-48-1) is a chemical compound with the molecular formula C7H4Br2F2O and a molecular weight of 301.91 g/mol. IUPAC name: 1,3-dibromo-5-(difluoromethoxy)benzene. InChIKey: SZRPGGXNTIUCCQ-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F2O |
|---|---|
| Molecular weight | 301.91 g/mol |
| IUPAC name | 1,3-dibromo-5-(difluoromethoxy)benzene |
| InChIKey | SZRPGGXNTIUCCQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)OC(F)F |
Computed by PubChem (NCBI)