CAS 1000575-26-7 appears in our catalog under these names: 1,4-Dibromo-2-(difluoromethoxy)benzene, 95%, 1,4-Dibromo-2-(difluoromethoxy)benzene, 95+%, 1,4-dibromo-2-(difluoromethoxy)benzene. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1,4-dibromo-2-(difluoromethoxy)benzene (CAS 1000575-26-7) is a chemical compound with the molecular formula C7H4Br2F2O and a molecular weight of 301.91 g/mol. IUPAC name: 1,4-dibromo-2-(difluoromethoxy)benzene. InChIKey: RWPUJYIGUYKGBB-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2F2O |
|---|---|
| Molecular weight | 301.91 g/mol |
| IUPAC name | 1,4-dibromo-2-(difluoromethoxy)benzene |
| InChIKey | RWPUJYIGUYKGBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)F)Br |
Computed by PubChem (NCBI)