cas: 40718-08-9 — see every product listed under this CAS number, including other names
3,5-Dibromo-2-hydroxybenzonitrile 95% (CAS 40718-08-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A364196-1g |
| cas | 40718-08-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 364.81 Pln | |
| Ambeed | 25g | 1249.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A364196 |
3,5-dibromo-2-hydroxybenzonitrile (CAS 40718-08-9) is a chemical compound with the molecular formula C7H3Br2NO and a molecular weight of 276.91 g/mol. IUPAC name: 3,5-dibromo-2-hydroxybenzonitrile. InChIKey: IZOWHVRXNOVUGY-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NO |
|---|---|
| Molecular weight | 276.91 g/mol |
| IUPAC name | 3,5-dibromo-2-hydroxybenzonitrile |
| InChIKey | IZOWHVRXNOVUGY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)O)Br)Br |
Computed by PubChem (NCBI)