cas: 40718-08-9 — see every product listed under this CAS number, including other names
3,5-Dibromo-2-hydroxybenzonitrile, 98%, 98% (CAS 40718-08-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZ1Q-100mg |
| cas | 40718-08-9 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 100g | 2752.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dibromo-2-hydroxybenzonitrile (CAS 40718-08-9) is a chemical compound with the molecular formula C7H3Br2NO and a molecular weight of 276.91 g/mol. IUPAC name: 3,5-dibromo-2-hydroxybenzonitrile. InChIKey: IZOWHVRXNOVUGY-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NO |
|---|---|
| Molecular weight | 276.91 g/mol |
| IUPAC name | 3,5-dibromo-2-hydroxybenzonitrile |
| InChIKey | IZOWHVRXNOVUGY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)O)Br)Br |
Computed by PubChem (NCBI)