cas: 650140-84-4 — see every product listed under this CAS number, including other names
3,5-Dibromo-4-Methoxypyridine-N-Oxide, 98%, 98% (CAS 650140-84-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECVX-100mg |
| cas | 650140-84-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 578.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium (CAS 650140-84-4) is a chemical compound with the molecular formula C6H5Br2NO2 and a molecular weight of 282.92 g/mol. IUPAC name: 3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium. InChIKey: KAYQEYHOGFRTAL-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2NO2 |
|---|---|
| Molecular weight | 282.92 g/mol |
| IUPAC name | 3,5-dibromo-4-methoxy-1-oxidopyridin-1-ium |
| InChIKey | KAYQEYHOGFRTAL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=[N+](C=C1Br)[O-])Br |
Computed by PubChem (NCBI)