cas: 1242329-23-2 — see every product listed under this CAS number, including other names
3,5-Dibromo-4-chloropyridin-2-amine, 97%, 97% (CAS 1242329-23-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LPF-250mg |
| cas | 1242329-23-2 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 496.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,5-dibromo-4-chloropyridin-2-amine (CAS 1242329-23-2) is a chemical compound with the molecular formula C5H3Br2ClN2 and a molecular weight of 286.35 g/mol. IUPAC name: 3,5-dibromo-4-chloropyridin-2-amine. InChIKey: LGSFOPKQUAVZJX-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2ClN2 |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | 3,5-dibromo-4-chloropyridin-2-amine |
| InChIKey | LGSFOPKQUAVZJX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Br)Cl)Br |
Computed by PubChem (NCBI)