cas: 1451393-11-5 — see every product listed under this CAS number, including other names
3,5-Dichloro-2,6-difluorophenylboronic acid (CAS 1451393-11-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627845-1G |
| cas | 1451393-11-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5631.37 Pln | |
| Fluorochem | 5g | 16757.66 Pln |
| delivery time | 3-4 weeks |
|---|
(3,5-dichloro-2,6-difluorophenyl)boronic acid (CAS 1451393-11-5) is a chemical compound with the molecular formula C6H3BCl2F2O2 and a molecular weight of 226.80 g/mol. IUPAC name: (3,5-dichloro-2,6-difluorophenyl)boronic acid. InChIKey: JLWBTHQVEUONHW-UHFFFAOYSA-N.
| Molecular formula | C6H3BCl2F2O2 |
|---|---|
| Molecular weight | 226.80 g/mol |
| IUPAC name | (3,5-dichloro-2,6-difluorophenyl)boronic acid |
| InChIKey | JLWBTHQVEUONHW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC(=C1F)Cl)Cl)F)(O)O |
Computed by PubChem (NCBI)