CAS 1451393-11-5 appears in our catalog under these names: 3,5-Dichloro-2,6-difluorophenylboronic acid, 95%, 3,5-Dichloro-2,6-difluorophenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
(3,5-dichloro-2,6-difluorophenyl)boronic acid (CAS 1451393-11-5) is a chemical compound with the molecular formula C6H3BCl2F2O2 and a molecular weight of 226.80 g/mol. IUPAC name: (3,5-dichloro-2,6-difluorophenyl)boronic acid. InChIKey: JLWBTHQVEUONHW-UHFFFAOYSA-N.
| Molecular formula | C6H3BCl2F2O2 |
|---|---|
| Molecular weight | 226.80 g/mol |
| IUPAC name | (3,5-dichloro-2,6-difluorophenyl)boronic acid |
| InChIKey | JLWBTHQVEUONHW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC(=C1F)Cl)Cl)F)(O)O |
Computed by PubChem (NCBI)