cas: 186805-79-8 — see every product listed under this CAS number, including other names
3,5-Dichloro-4-(phenylmethoxy)phenol, 98% (CAS 186805-79-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631874-250MG |
| cas | 186805-79-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 659.16 Pln | |
| Fluorochem | 1g | 903.87 Pln | |
| Fluorochem | 5g | 3090.60 Pln | |
| Fluorochem | 10g | 5220.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,5-dichloro-4-phenylmethoxyphenol (CAS 186805-79-8) is a chemical compound with the molecular formula C13H10Cl2O2 and a molecular weight of 269.12 g/mol. IUPAC name: 3,5-dichloro-4-phenylmethoxyphenol. InChIKey: YPMZAYVEEAAJHT-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O2 |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 3,5-dichloro-4-phenylmethoxyphenol |
| InChIKey | YPMZAYVEEAAJHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)O)Cl |
Computed by PubChem (NCBI)