CAS 2056284-95-6 appears in our catalog under these names: Dichloro-BPF, >95% (HPLC), Dichloro-BPF, 2,6-Dichloro-4-(4-hydroxybenzyl)phenol, 98%. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, 10mg, 50mg, on request.
2,6-dichloro-4-[(4-hydroxyphenyl)methyl]phenol (CAS 2056284-95-6) is a chemical compound with the molecular formula C13H10Cl2O2 and a molecular weight of 269.12 g/mol. IUPAC name: 2,6-dichloro-4-[(4-hydroxyphenyl)methyl]phenol. InChIKey: ZNQVFXGEJBVZRU-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O2 |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 2,6-dichloro-4-[(4-hydroxyphenyl)methyl]phenol |
| InChIKey | ZNQVFXGEJBVZRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC(=C(C(=C2)Cl)O)Cl)O |
Computed by PubChem (NCBI)