3,5-Diethoxybenzoic acid, 98%
cas: 124480-95-1 — see every product listed under this CAS number, including other names
3,5-Diethoxybenzoic acid, 98% (CAS 124480-95-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A362474-250mg |
| cas | 124480-95-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 859.88 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 25g | 1326.80 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 497.63 Pln | |
| BLDpharm | 10g | 919.70 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3,5-diethoxybenzoic acid (CAS 124480-95-1) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3,5-diethoxybenzoic acid. InChIKey: FCSNGXDTYSQXPA-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3,5-diethoxybenzoic acid |
| InChIKey | FCSNGXDTYSQXPA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(=O)O)OCC |
Computed by PubChem (NCBI)
