CAS 93206-09-8 appears in our catalog under these names: 2-[2-(Benzyloxy)ethoxy]acetic acid, 98%, BnO–PEG1–CH2COOH, 2-(2-(Benzyloxy)ethoxy)acetic acid, 98%, 98%, BnO-PEG1-CH2COOH, 99.80%, Acetic acid, [2-(phenylmethoxy)ethoxy]-, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 500mg, 100mg, 25g, 100 mg, 500 mg.
2-(2-phenylmethoxyethoxy)acetic acid (CAS 93206-09-8) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2-phenylmethoxyethoxy)acetic acid. InChIKey: WEBYLMXBPGYVLS-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(2-phenylmethoxyethoxy)acetic acid |
| InChIKey | WEBYLMXBPGYVLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCC(=O)O |
Computed by PubChem (NCBI)