cas: 213382-46-8 — see every product listed under this CAS number, including other names
3,5-Difluoro-2-nitrobenzaldehyde, 95%, 95% (CAS 213382-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K5S0-100mg |
| cas | 213382-46-8 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 707.60 Pln | |
| Chemat | 250mg | 1067.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-2-nitrobenzaldehyde (CAS 213382-46-8) is a chemical compound with the molecular formula C7H3F2NO3 and a molecular weight of 187.10 g/mol. IUPAC name: 3,5-difluoro-2-nitrobenzaldehyde. InChIKey: PXEALGANJOODMT-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO3 |
|---|---|
| Molecular weight | 187.10 g/mol |
| IUPAC name | 3,5-difluoro-2-nitrobenzaldehyde |
| InChIKey | PXEALGANJOODMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)