cas: 1031857-96-1 — see every product listed under this CAS number, including other names
3,5-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%, 97% (CAS 1031857-96-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q8Q-100mg |
| cas | 1031857-96-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 904.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1031857-96-1) is a chemical compound with the molecular formula C13H15BF2O4 and a molecular weight of 284.07 g/mol. IUPAC name: 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: CLYXVWDLNOWTQF-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2O4 |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | CLYXVWDLNOWTQF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2F)C(=O)O)F |
Computed by PubChem (NCBI)