cas: 937796-06-0 — see every product listed under this CAS number, including other names
3,5-Dimethyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1H-pyrazole, 95% (CAS 937796-06-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213074-250MG |
| cas | 937796-06-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 1143.37 Pln | |
| Fluorochem | 5g | 3793.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (CAS 937796-06-0) is a chemical compound with the molecular formula C17H23BN2O2 and a molecular weight of 298.2 g/mol. IUPAC name: 3,5-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole. InChIKey: SERWCEBXGSSDRB-UHFFFAOYSA-N.
| Molecular formula | C17H23BN2O2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 3,5-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| InChIKey | SERWCEBXGSSDRB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3C(=CC(=N3)C)C |
Computed by PubChem (NCBI)