CAS 1430750-33-6 is the registry number for 1-(1-Phenyl-ethyl)-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-phenylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1430750-33-6) is a chemical compound with the molecular formula C17H23BN2O2 and a molecular weight of 298.2 g/mol. IUPAC name: 1-(1-phenylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: YZRNICKGRPOILY-UHFFFAOYSA-N.
| Molecular formula | C17H23BN2O2 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | 1-(1-phenylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | YZRNICKGRPOILY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)