cas: 14531-55-6 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-nitro-1H-pyrazole 98% (CAS 14531-55-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362346-1g |
| cas | 14531-55-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 464.94 Pln | |
| Ambeed | 500g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A362346 |
3,5-dimethyl-4-nitro-1H-pyrazole (CAS 14531-55-6) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 3,5-dimethyl-4-nitro-1H-pyrazole. InChIKey: OFQCJVVJRNPSET-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitro-1H-pyrazole |
| InChIKey | OFQCJVVJRNPSET-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)