cas: 14531-55-6 — see every product listed under this CAS number, including other names
3,5-Dimethyl-4-nitro-1H-pyrazole, 98%, 98% (CAS 14531-55-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 50g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KSI-5g |
| cas | 14531-55-6 |
| size | 5g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 328.40 Pln | |
| Chemat | 500g | 1425.60 Pln | |
| Chemat | 50g | 198.80 Pln | |
| Chemat | 250g | 712.40 Pln | |
| Chemat | 1kg | 2766.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dimethyl-4-nitro-1H-pyrazole (CAS 14531-55-6) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 3,5-dimethyl-4-nitro-1H-pyrazole. InChIKey: OFQCJVVJRNPSET-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitro-1H-pyrazole |
| InChIKey | OFQCJVVJRNPSET-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)