cas: 401-99-0 — see every product listed under this CAS number, including other names
3,5-Dinitrobenzotrifluoride, ≥98%, ≥98% (CAS 401-99-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 200g, 300g, 400g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144JR-10g |
| cas | 401-99-0 |
| size | 10g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 102.80 Pln | |
| Chemat | 100g | 544.40 Pln | |
| Chemat | 200g | 976.40 Pln | |
| Chemat | 300g | 1413.20 Pln | |
| Chemat | 400g | 1845.20 Pln | |
| Chemat | 500g | 2160.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1,3-dinitro-5-(trifluoromethyl)benzene (CAS 401-99-0) is a chemical compound with the molecular formula C7H3F3N2O4 and a molecular weight of 236.10 g/mol. IUPAC name: 1,3-dinitro-5-(trifluoromethyl)benzene. InChIKey: QZADIXWDDVQVKM-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2O4 |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 1,3-dinitro-5-(trifluoromethyl)benzene |
| InChIKey | QZADIXWDDVQVKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)