3,5-Dinitrobenzotrifluoride
cas: 401-99-0 — see every product listed under this CAS number, including other names
3,5-Dinitrobenzotrifluoride (CAS 401-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004963-1G |
| cas | 401-99-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 138.51 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 419.66 Pln | |
| Fluorochem | 500g | 1559.89 Pln |
properties
| delivery time | 2-3 weeks |
|---|
1,3-dinitro-5-(trifluoromethyl)benzene (CAS 401-99-0) is a chemical compound with the molecular formula C7H3F3N2O4 and a molecular weight of 236.10 g/mol. IUPAC name: 1,3-dinitro-5-(trifluoromethyl)benzene. InChIKey: QZADIXWDDVQVKM-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2O4 |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 1,3-dinitro-5-(trifluoromethyl)benzene |
| InChIKey | QZADIXWDDVQVKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)