3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diamine, 97%
cas: 332941-25-0 — see every product listed under this CAS number, including other names
3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diamine, 97% (CAS 332941-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867266-100MG |
| cas | 332941-25-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 1997.23 Pln | |
| Fluorochem | 10g | 3934.05 Pln | |
| Fluorochem | 25g | 9203.03 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 332941-25-0) is a chemical compound with the molecular formula C16H36N2O7 and a molecular weight of 368.47 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: MWECBIRKDAZDRL-UHFFFAOYSA-N.
| Molecular formula | C16H36N2O7 |
|---|---|
| Molecular weight | 368.47 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | MWECBIRKDAZDRL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)
Synonyms:
3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diamine, Amino-PEG7-Amine, alpha,omega-Bis-amino octa(ethylene glycol), O,O inverted exclamation marka-Bis(2-aMinoethyl)polyethylene Glycol, O,O?-Bis(2-aminoethyl)hexaethylene Glycol, O,O'-Bis(2-aminoethyl)hexaethylene Glycol, O,O inverted exclamation marka-Bis(2-aminoethyl)hexaethylene Glycol, orb1909523, ?,?-BIs(amino)-octaethylene glycol, O,O 2-Bis(2-aminoethyl)hexaethylene Glycol