Amino-PEG7-amine 95%
cas: 332941-25-0 — see every product listed under this CAS number, including other names
Amino-PEG7-amine 95% (CAS 332941-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754234-100mg |
| cas | 332941-25-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 2033.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754234 |
2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 332941-25-0) is a chemical compound with the molecular formula C16H36N2O7 and a molecular weight of 368.47 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: MWECBIRKDAZDRL-UHFFFAOYSA-N.
| Molecular formula | C16H36N2O7 |
|---|---|
| Molecular weight | 368.47 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | MWECBIRKDAZDRL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)
Synonyms:
3,6,9,12,15,18,21-Heptaoxatricosane-1,23-diamine, Amino-PEG7-Amine, alpha,omega-Bis-amino octa(ethylene glycol), O,O inverted exclamation marka-Bis(2-aMinoethyl)polyethylene Glycol, O,O?-Bis(2-aminoethyl)hexaethylene Glycol, O,O'-Bis(2-aminoethyl)hexaethylene Glycol, O,O inverted exclamation marka-Bis(2-aminoethyl)hexaethylene Glycol, orb1909523, ?,?-BIs(amino)-octaethylene glycol, O,O 2-Bis(2-aminoethyl)hexaethylene Glycol