3,6,9,12,15,18-Hexaoxaeicosanedioic acid, 95%
cas: 77855-76-6 — see every product listed under this CAS number, including other names
3,6,9,12,15,18-Hexaoxaeicosanedioic acid, 95% (CAS 77855-76-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114AW0-100mg |
| cas | 77855-76-6 |
| size | 100mg |
| availability | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 1504.40 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 1054.85 Pln | |
| Fluorochem | 50mg | 174.96 Pln | |
| Fluorochem | 100mg | 211.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 77855-76-6) is a chemical compound with the molecular formula C14H26O10 and a molecular weight of 354.35 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: DCQRSABUSOYSIY-UHFFFAOYSA-N.
| Molecular formula | C14H26O10 |
|---|---|
| Molecular weight | 354.35 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | DCQRSABUSOYSIY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCC(=O)O)OCCOCCOCC(=O)O |
Computed by PubChem (NCBI)