cas: 1057672-68-0 — see every product listed under this CAS number, including other names
3,6-Dichloro-4-(trifluoromethyl)pyridazine 98% (CAS 1057672-68-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A440865-100mg |
| cas | 1057672-68-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1104.63 Pln | |
| Ambeed | 5g | 3023.69 Pln | |
| Ambeed | 25g | 10410.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A440865 |
3,6-dichloro-4-(trifluoromethyl)pyridazine (CAS 1057672-68-0) is a chemical compound with the molecular formula C5HCl2F3N2 and a molecular weight of 216.97 g/mol. IUPAC name: 3,6-dichloro-4-(trifluoromethyl)pyridazine. InChIKey: FCAYXJJTFRBHIQ-UHFFFAOYSA-N.
| Molecular formula | C5HCl2F3N2 |
|---|---|
| Molecular weight | 216.97 g/mol |
| IUPAC name | 3,6-dichloro-4-(trifluoromethyl)pyridazine |
| InChIKey | FCAYXJJTFRBHIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)