3,6-Dichloro-4-(trifluoromethyl)pyridazine, 96%
cas: 1057672-68-0 — see every product listed under this CAS number, including other names
3,6-Dichloro-4-(trifluoromethyl)pyridazine, 96% (CAS 1057672-68-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094909-100MG |
| cas | 1057672-68-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 500mg | 643.54 Pln | |
| Fluorochem | 1g | 987.17 Pln | |
| Fluorochem | 5g | 2923.99 Pln | |
| Fluorochem | 10g | 5011.79 Pln | |
| Fluorochem | 25g | 11962.47 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
3,6-dichloro-4-(trifluoromethyl)pyridazine (CAS 1057672-68-0) is a chemical compound with the molecular formula C5HCl2F3N2 and a molecular weight of 216.97 g/mol. IUPAC name: 3,6-dichloro-4-(trifluoromethyl)pyridazine. InChIKey: FCAYXJJTFRBHIQ-UHFFFAOYSA-N.
| Molecular formula | C5HCl2F3N2 |
|---|---|
| Molecular weight | 216.97 g/mol |
| IUPAC name | 3,6-dichloro-4-(trifluoromethyl)pyridazine |
| InChIKey | FCAYXJJTFRBHIQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)