3,6-Dichloropyridazine-4-carboxamide, 98%
cas: 27427-66-3 — see every product listed under this CAS number, including other names
3,6-Dichloropyridazine-4-carboxamide, 98% (CAS 27427-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F231751-100MG |
| cas | 27427-66-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 778.91 Pln | |
| Fluorochem | 5g | 2549.12 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 765.31 Pln | |
| Ambeed | 5g | 2478.56 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 477.20 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 819.74 Pln | |
| BLDpharm | 5g | 2663.53 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
3,6-dichloropyridazine-4-carboxamide (CAS 27427-66-3) is a chemical compound with the molecular formula C5H3Cl2N3O and a molecular weight of 192.00 g/mol. IUPAC name: 3,6-dichloropyridazine-4-carboxamide. InChIKey: NXVUUPORAZUSGG-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,6-dichloropyridazine-4-carboxamide |
| InChIKey | NXVUUPORAZUSGG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)